CAS 6301-48-0
:2,3,5-tri-O-benzoylpentofuranosyl fluoride
Description:
2,3,5-Tri-O-benzoylpentofuranosyl fluoride is a chemical compound that belongs to the class of glycosyl fluorides, which are derivatives of sugars where a hydroxyl group is replaced by a fluoride atom. This compound features a furanose ring structure, characteristic of pentose sugars, and is further modified by the presence of three benzoyl groups at the 2, 3, and 5 positions, which enhance its stability and lipophilicity. The benzoyl groups also serve as protecting groups, making the compound useful in synthetic organic chemistry, particularly in glycosylation reactions. The presence of the fluoride atom is significant as it can participate in nucleophilic substitution reactions, making this compound a valuable intermediate in the synthesis of various glycosides and oligosaccharides. Additionally, the compound is typically a white to off-white solid, and its reactivity and stability can be influenced by factors such as solvent choice and temperature. As with many chemical substances, proper handling and safety precautions are essential due to potential hazards associated with its use.
Formula:C26H21FO7
InChI:InChI=1/C26H21FO7/c27-23-22(34-26(30)19-14-8-3-9-15-19)21(33-25(29)18-12-6-2-7-13-18)20(32-23)16-31-24(28)17-10-4-1-5-11-17/h1-15,20-23H,16H2
SMILES:c1ccc(cc1)C(=O)OCC1C(C(C(F)O1)OC(=O)c1ccccc1)OC(=O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2,3,5-Tri-O-benzoyl-β-D-arabinofuranosyl fluoride
CAS:<p>2,3,5-Tri-O-benzoyl-β-D-arabinofuranosyl fluoride</p>Color and Shape:SolidMolecular weight:464.44g/mol

