CAS 63018-40-6
:methyl tetraphen-7-ylacetate
Description:
Methyl tetraphen-7-ylacetate, identified by its CAS number 63018-40-6, is an organic compound characterized by its ester functional group. This substance features a methyl ester derived from tetraphenylacetic acid, which contributes to its complex structure and potential applications. The presence of multiple phenyl groups in its structure often imparts unique electronic and steric properties, making it of interest in various fields, including organic synthesis and materials science. Methyl tetraphen-7-ylacetate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is generally soluble in organic solvents, which enhances its utility in chemical reactions and formulations. The compound may exhibit interesting reactivity due to the presence of the ester group, allowing for hydrolysis or transesterification under appropriate conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, methyl tetraphen-7-ylacetate represents a versatile compound with potential applications in various chemical processes.
Formula:C21H16O2
InChI:InChI=1/C21H16O2/c1-23-21(22)13-20-17-9-5-3-7-15(17)12-19-16-8-4-2-6-14(16)10-11-18(19)20/h2-12H,13H2,1H3
SMILES:COC(=O)Cc1c2ccccc2cc2c3ccccc3ccc12
Synonyms:- Benz[a]anthracene-7-acetic Acid Methyl Ester
- Methyl Benz[a]anthracene-7-acetate
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Benz[A]anthracene-7-acetic acid methyl ester
CAS:Please enquire for more information about Benz[A]anthracene-7-acetic acid methyl ester including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C21H16O2Purity:Min. 95%Molecular weight:300.3 g/mol
