CAS 63018-69-9
:tetraphen-7-ylacetonitrile
Description:
Tetraphen-7-ylacetonitrile, with the CAS number 63018-69-9, is an organic compound characterized by its unique structure, which features a central acetonitrile group attached to a tetraphenyl moiety. This compound typically exhibits a high degree of stability due to the presence of multiple phenyl rings, which can provide significant steric hindrance and electronic effects. It is generally insoluble in water but may dissolve in organic solvents, reflecting its hydrophobic nature. The presence of the nitrile functional group (-C≡N) contributes to its reactivity, allowing it to participate in various chemical reactions, such as nucleophilic additions or substitutions. Tetraphen-7-ylacetonitrile may also exhibit interesting optical properties, making it a candidate for applications in materials science or organic electronics. Its synthesis often involves multi-step organic reactions, and it may be used in research related to organic synthesis, medicinal chemistry, or as a building block for more complex molecules. Overall, its unique structural features and functional groups make it a compound of interest in various chemical fields.
Formula:C20H13N
InChI:InChI=1/C20H13N/c21-12-11-19-17-8-4-2-6-15(17)13-20-16-7-3-1-5-14(16)9-10-18(19)20/h1-10,13H,11H2
SMILES:c1ccc2c(c1)ccc1c(CC#N)c3ccccc3cc21
Synonyms:- nz[a]anthracene-7-acetonitrile
- Benz[a]anthracene-7-acetonitrile
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Benz[a]anthracene-7-acetonitrile
CAS:Controlled ProductApplications Benzanthracene derivative. Intermediate in the synthesis of growth-inhibitory polycyclic compounds.
References Badger, G. M. & Cook, J. W.; J. Chem. Soc. 409 (1940)Formula:C20H13NColor and Shape:NeatMolecular weight:267.32Benz[A]anthracene-7-acetonitrile
CAS:Please enquire for more information about Benz[A]anthracene-7-acetonitrile including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C20H13NPurity:Min. 95%Molecular weight:267.3 g/mol

