CAS 6302-55-2
:1-(4-chlorophenyl)butane-1,3-dione
Description:
1-(4-Chlorophenyl)butane-1,3-dione, also known by its CAS number 6302-55-2, is an organic compound characterized by its diketone structure, featuring a butane backbone with two carbonyl (C=O) groups located at the first and third positions. The presence of a 4-chlorophenyl group at the first position significantly influences its chemical properties, including its reactivity and solubility. This compound typically appears as a solid or liquid, depending on the specific conditions, and is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity is largely attributed to the electrophilic nature of the carbonyl groups, which can participate in various chemical reactions, such as nucleophilic additions and condensation reactions. Additionally, the chlorophenyl substituent can enhance the compound's biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with many organic compounds, it may pose health risks if not managed properly.
Formula:C10H9ClO2
InChI:InChI=1/C10H9ClO2/c1-7(12)6-10(13)8-2-4-9(11)5-3-8/h2-5H,6H2,1H3
SMILES:CC(=O)CC(=O)c1ccc(cc1)Cl
Synonyms:- 1,3-Butanedione, 1-(4-chlorophenyl)-
- 4-(4-Chlorophenyl)-4-Hydroxybut-3-En-2-One
- 1-(4-Chlorophenyl)butane-1,3-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(4-Chlorophenyl)butane-1,3-dione
CAS:Formula:C10H9ClO2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:196.631-(4-Chlorophenyl)butane-1,3-dione
CAS:Trichloroacetic acid is an organic compound that is used in the evaluation of chloride. The compound has a functional theory and can be used to determine if a molecule contains chloride. Trichloroacetic acid is also used for the validation of chloride as a tracer element. Trichloroacetic acid can be used in the detection of impurities in a molecule by reacting with them, which will result in the formation of new molecules. It has been shown that trichloroacetic acid can interact with transition metal ions and hydrogen bond with water molecules, which may lead to vibrational and intramolecular hydrogen changes. Trichloroacetic acid has been deuterated to aid in its thermodynamic properties.Formula:C10H9ClO2Purity:Min. 95%Molecular weight:196.63 g/mol




