CAS 6302-65-4
:methyl 4-sulfanylbenzoate
Description:
Methyl 4-sulfanylbenzoate, with the CAS number 6302-65-4, is an organic compound characterized by its ester functional group and a thiol substituent. It features a methyl ester derived from 4-sulfanylbenzoic acid, where the sulfanyl (or thiol) group (-SH) is attached to the benzene ring at the para position relative to the carboxylate group. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as a building block in the development of pharmaceuticals and agrochemicals. The presence of the thiol group imparts unique reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and as a reducing agent. Additionally, methyl 4-sulfanylbenzoate may exhibit specific odor characteristics, often associated with sulfur-containing compounds. Safety precautions should be observed when handling this substance, as thiols can be malodorous and may pose health risks if inhaled or ingested.
Formula:C8H8O2S
InChI:InChI=1/C8H8O2S/c1-10-8(9)6-2-4-7(11)5-3-6/h2-5,11H,1H3
SMILES:COC(=O)c1ccc(cc1)S
Synonyms:- Benzoic Acid, 4-Mercapto-, Methyl Ester
- Methyl 4-sulfanylbenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 4-sulfanylbenzoate
CAS:Formula:C8H8O2SPurity:98%Color and Shape:SolidMolecular weight:168.2129Methyl 4-mercaptobenzoate
CAS:Methyl 4-mercaptobenzoateFormula:C8H8O2SPurity:95%Color and Shape: off-white solidMolecular weight:168.21g/molMethyl 4-Mercaptobenzoate
CAS:Controlled ProductFormula:C8H8O2SColor and Shape:NeatMolecular weight:168.21Methyl 4-mercaptobenzoate
CAS:<p>Methyl 4-mercaptobenzoate is an organic compound that can reversibly bind to sulfide ions. This compound has been shown to be a ligand for monolayers of sodium sulfide and rhenium, which were found to have significant functionalities. Methyl 4-mercaptobenzoate was shown to have a photophysical behavior with the formation of alcohols as reaction products. It also has the ability to transport hydrophobic molecules through lipid bilayers. In addition, it has been shown that methyl 4-mercaptobenzoate induces an inflammatory response in cells.</p>Formula:C8H8O2SPurity:Min. 95%Color and Shape:Off-White PowderMolecular weight:168.21 g/mol




