CAS 63053-14-5
:6-methoxy-2-(pyridin-2-yl)-1H-benzimidazole
Description:
6-Methoxy-2-(pyridin-2-yl)-1H-benzimidazole is a chemical compound characterized by its unique structural features, which include a benzimidazole core substituted with a methoxy group and a pyridine ring. The presence of the methoxy group enhances its solubility and can influence its biological activity. The pyridine moiety contributes to the compound's potential as a ligand in various chemical reactions and biological interactions. This compound is often studied for its pharmacological properties, particularly in the context of medicinal chemistry, where it may exhibit activities such as antimicrobial, anti-inflammatory, or anticancer effects. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in drug development. Additionally, the compound's stability, reactivity, and solubility can be influenced by environmental factors such as pH and temperature, which are important considerations in both laboratory and therapeutic applications. Overall, 6-methoxy-2-(pyridin-2-yl)-1H-benzimidazole represents a versatile scaffold in organic and medicinal chemistry.
Formula:C13H11N3O
InChI:InChI=1/C13H11N3O/c1-17-9-5-6-10-12(8-9)16-13(15-10)11-4-2-3-7-14-11/h2-8H,1H3,(H,15,16)
SMILES:COc1ccc2c(c1)[nH]c(c1ccccn1)n2
Synonyms:- 1H-benzimidazole, 5-methoxy-2-(2-pyridinyl)-
- 5-methoxy-2-(pyridin-2-yl)-1H-benzimidazole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
AI-4-57 hydrochloride
CAS:<p>AI-4-57 hydrochloride is a peptide that binds to the receptor for Substance P, and inhibits the binding of Substance P to its receptors. It also inhibits the release of substance P from sensory nerve terminals. AI-4-57 hydrochloride has been shown to be a potent inhibitor of ion channels, including potassium channels and calcium channels. This peptide is also able to inhibit the activity of ligand gated ion channels such as nicotinic acetylcholine receptors, GABA receptors, and 5HT3 serotonin receptors. AI-4-57 hydrochloride is a high purity reagent with CAS number 63053-14-5. It can be used as an antibody in immunohistochemistry or western blotting experiments.<br>AI-4-57 hydrochloride can be used as a research tool for cell biology studies investigating protein interactions or receptor activation.END>></p>Formula:C13H11N3OPurity:Min. 95%Molecular weight:225.25 g/molAI-4-57 Hydrochloride
CAS:AI-4-57 Hydrochloride is a ligand to the CBFß. AI-4-57 Hydrochloride is a modest potency inhibitor of the binding of wildtype CBFß to the RUNX1 Runt domain.Formula:C13H11N3OPurity:98%Color and Shape:SolidMolecular weight:225.25

