CAS 63069-49-8
:2-Amino-5-fluorobenzamide
Description:
2-Amino-5-fluorobenzamide is an organic compound characterized by the presence of an amino group (-NH2) and a fluorine atom attached to a benzene ring, specifically at the 5-position relative to the amide functional group (-C(=O)NH2). This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to its ability to form hydrogen bonds. The presence of the amino group contributes to its basicity, while the fluorine atom can influence its reactivity and biological activity due to its electronegative nature. 2-Amino-5-fluorobenzamide is of interest in medicinal chemistry and research due to its potential applications in pharmaceuticals, particularly as a building block for the synthesis of various biologically active compounds. Its molecular structure allows for interactions with biological targets, making it a subject of study in drug development and chemical biology. Safety data should be consulted for handling and usage, as with all chemical substances.
Formula:C7H7FN2O
InChI:InChI=1S/C7H7FN2O/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H2,10,11)
InChI key:InChIKey=RHJMYIPLYKQZJM-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=C(N)C=CC(F)=C1
Synonyms:- 5-Fluoro-2-aminobenzamide
- Benzamide,2-amino-5-fluoro-
- 2-Amino-5-fluorobenzamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Amino-5-fluorobenzamide
CAS:Formula:C7H7FN2OPurity:>98.0%(HPLC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:154.142-AMINO-5-FLUOROBENZAMIDE
CAS:Formula:C7H7FN2OPurity:97%Color and Shape:SolidMolecular weight:154.14172-Amino-5-fluorobenzamide
CAS:2-Amino-5-fluorobenzamideFormula:C7H7FN2OPurity:97%Color and Shape:White To Off White PowderMolecular weight:154.14g/mol2-Amino-5-fluorobenzamide
CAS:Formula:C7H7FN2OPurity:95%Color and Shape:SolidMolecular weight:154.1442-Amino-5-fluorobenzamide
CAS:<p>2-Amino-5-fluorobenzamide (2AFB) is a compound that has been shown to have neurotoxic properties. 2AFB is a ring-opening agent, which means it can open the six-membered ring of aromatic compounds such as benzene or pyridine. 2AFB also has affinity for metal ions and therefore can be used in magnetic separations. The reaction system of 2AFB includes an enzyme, pentylenetetrazole (PTZ), that catalyzes the reaction between 2AFB and its substrate, 4-nitrophenol (4NP). This reaction produces free radicals that react with oxygen to produce peroxides. These peroxides are then detected by a chemiluminescence assay. In this way, the amount of 2AFB and 4NP can be measured quantitatively.<br>2AFB also has antioxidant properties, which may be due to its ability to scavenge free radicals from</p>Formula:C7H7FN2OPurity:Min. 95%Color and Shape:PowderMolecular weight:154.14 g/mol




