CAS 63069-50-1
:4-Amino-3-fluorobenzonitrile
Description:
4-Amino-3-fluorobenzonitrile, with the CAS number 63069-50-1, is an organic compound characterized by the presence of an amino group (-NH2) and a fluorine atom attached to a benzene ring that also contains a nitrile group (-C≡N). This compound typically appears as a solid and is known for its aromatic properties due to the benzene structure. The amino group contributes to its potential as a building block in pharmaceuticals and agrochemicals, while the nitrile group can participate in various chemical reactions, including nucleophilic additions and cycloadditions. The fluorine atom can influence the compound's reactivity and lipophilicity, making it valuable in medicinal chemistry for enhancing biological activity. Additionally, 4-amino-3-fluorobenzonitrile may exhibit specific solubility characteristics in organic solvents, which can be important for its application in synthesis and formulation. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H5FN2
InChI:InChI=1/C19H18F6O6S2/c1-13-3-7-15(8-4-13)32(26,27)30-11-17(20,21)19(24,25)18(22,23)12-31-33(28,29)16-9-5-14(2)6-10-16/h3-10H,11-12H2,1-2H3
InChI key:InChIKey=RLMBRRQWBTWGMB-UHFFFAOYSA-N
SMILES:C(#N)C1=CC(F)=C(N)C=C1
Synonyms:- 2,2,3,3,4,4-Hexafluoropentane-1,5-Diyl Bis(4-Methylbenzenesulfonate)
- 2-Fluoro-4-cyanoaniline
- 3-Fluoro-4-aminobenzonitrile
- 4-Amino-3-fluorobenzenecarbonitrile
- 4-Cyano-2-fluoroaniline
- Benzonitrile, 4-amino-3-fluoro-
- 4-Amino-3-fluorobenzonitrile
- 4-Amino-3-fluorobenzonitrile98%
- 4-Amino-3-fluorobenzonitrile 98%
- 4-Amino-3-Fluorobenzonitrile 3-Fluoro-4-Aminobenzonitrile
- BUTTPARK 144\07-21
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Amino-3-fluorobenzonitrile
CAS:Formula:C7H5FN2Purity:97%Color and Shape:SolidMolecular weight:136.12644-Amino-3-fluorobenzonitrile
CAS:<p>4-Amino-3-fluorobenzonitrile</p>Formula:C7H5FN2Purity:98%Color and Shape: off-white solidMolecular weight:136.13g/mol4-Amino-3-fluorobenzonitrile
CAS:Formula:C7H5FN2Purity:>98.0%(GC)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:136.134-Amino-3-fluorobenzonitrile
CAS:<p>4-Amino-3-fluorobenzonitrile is an agonist of the DPP-4 enzyme. It has been shown to decrease blood glucose levels in a rat model. 4-Amino-3-fluorobenzonitrile binds to the active site of DPP-4, increasing its activity and inhibiting the breakdown of incretin hormones such as glucagon-like peptide 1 (GLP1) and glucose-dependent insulinotropic polypeptide (GIP). 4-Amino-3-fluorobenzonitrile inhibits glucagon secretion from pancreatic alpha cells, which leads to a decrease in blood glucose levels. The compound also inhibits GLP1 secretion from intestinal L cells, leading to decreased appetite and weight loss. 4-Amino-3-fluorobenzonitrile has been shown to be an agonist with biphenyl, which may explain its agonistic activity.</p>Formula:C7H5FN2Purity:Min. 95%Color and Shape:PowderMolecular weight:136.13 g/mol4-Amino-3-fluorobenzonitrile
CAS:Formula:C7H5FN2Purity:97%Color and Shape:SolidMolecular weight:136.129




