CAS 6307-30-8

4-(4-methoxy-2-methylphenyl)butanoic acid

Description:

4-(4-Methoxy-2-methylphenyl)butanoic acid, with the CAS number 6307-30-8, is an organic compound characterized by its aromatic structure and carboxylic acid functional group. It features a butanoic acid backbone, which is a four-carbon chain terminating in a carboxylic acid (-COOH) group. The compound also contains a para-substituted aromatic ring, where a methoxy group (-OCH3) and a methyl group (-CH3) are attached to the phenyl ring, influencing its chemical reactivity and solubility. This structure contributes to its potential applications in pharmaceuticals and organic synthesis. The presence of the methoxy group can enhance lipophilicity, while the carboxylic acid group can participate in hydrogen bonding, affecting its solubility in polar solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application.

Formula: C₁₂H₁₆O₃

InChI: InChI=1/C12H16O3/c1-9-8-11(15-2)7-6-10(9)4-3-5-12(13)14/h6-8H,3-5H2,1-2H3,(H,13,14)

SMILES: Cc1cc(ccc1CCCC(=O)O)OC

Synonyms:

• Benzenebutanoic acid, 4-methoxy-2-methyl-
• 4-(4-Methoxy-2-methylphenyl)butanoic acid