
CAS 6307-47-7
:4-(Ethylthio)-6-methyl-2-pyrimidinamine
Description:
4-(Ethylthio)-6-methyl-2-pyrimidinamine, with the CAS number 6307-47-7, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at positions 1 and 3. The presence of an ethylthio group at the 4-position and a methyl group at the 6-position contributes to its unique chemical properties. Typically, compounds of this nature exhibit moderate to high solubility in polar organic solvents, and their reactivity can be influenced by the functional groups attached to the pyrimidine ring. Such compounds may possess biological activity, making them of interest in medicinal chemistry and drug development. The ethylthio group can enhance lipophilicity, potentially affecting the compound's pharmacokinetics. Overall, 4-(Ethylthio)-6-methyl-2-pyrimidinamine is characterized by its heterocyclic structure, functional group diversity, and potential applications in various chemical and pharmaceutical contexts.
Formula:C7H11N3S
InChI:InChI=1S/C7H11N3S/c1-3-11-6-4-5(2)9-7(8)10-6/h4H,3H2,1-2H3,(H2,8,9,10)
InChI key:InChIKey=XJKJTJANVICBHQ-UHFFFAOYSA-N
SMILES:S(CC)C=1C=C(C)N=C(N)N1
Synonyms:- 2-Pyrimidinamine, 4-(ethylthio)-6-methyl-
- Pyrimidine, 2-amino-4-(ethylthio)-6-methyl-
- 4-(Ethylthio)-6-methyl-2-pyrimidinamine
- NSC 41333
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.