CAS 6307-83-1

3-BROMO-5-NITROBENZOIC ACID

Description:

3-Bromo-5-nitrobenzoic acid is an aromatic carboxylic acid characterized by the presence of both bromine and nitro functional groups on a benzoic acid framework. The bromine atom is located at the meta position (3-position) relative to the carboxylic acid group, while the nitro group is situated at the para position (5-position). This compound typically appears as a yellow to orange crystalline solid and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. It exhibits acidic properties due to the carboxylic acid group, allowing it to participate in various chemical reactions, including esterification and nucleophilic substitution. The presence of the bromine and nitro groups can influence its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 3-bromo-5-nitrobenzoic acid can be utilized in studies involving structure-activity relationships due to its unique electronic and steric properties. Safety precautions should be taken when handling this compound, as it may pose health hazards.

Formula: C₇H₃BrNO₄

InChI: InChI=1/C7H4BrNO4/c8-5-1-4(7(10)11)2-6(3-5)9(12)13/h1-3H,(H,10,11)/p-1

SMILES: c1c(cc(cc1Br)N(=O)=O)C(=O)[O-]

Synonyms:

• 3-Bromo-5-nitrobenzoic aci
• 3-Bromo-5-Nitrobenzoate

3-Bromo-5-nitrobenzoic acid

CAS: 6307-83-1

Formula: C₇H₄BrNO₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 246.0150

Ref: IN-DA0033MJ

3-Bromo-5-nitrobenzoic acid

CAS: 6307-83-1

3-Bromo-5-nitrobenzoic acid

Formula: C₇H₄BrNO₄

Purity: 95%

Color and Shape: light beige to light brown solid

Molecular weight: 246.01g/mol

Ref: 54-OR5735

3-Bromo-5-nitrobenzoic Acid

CAS: 6307-83-1

Formula: C₇H₄BrNO₄

Purity: >98.0%(GC)(T)

Color and Shape: White to Light yellow to Light orange powder to crystal

Molecular weight: 246.02

Ref: 3B-B3370

3-Bromo-5-nitrobenzoic acid

CAS: 6307-83-1

3-Bromo-5-nitrobenzoic acid is a cancer drug that inhibits the proliferation of cancer cells by binding to amines, which are protonated at physiological pH. This binding leads to an electronic interaction between the bromine atom and the electron cloud of the amine group. The bromine atom is then more attracted to the nucleus, causing it to emit a photon of light. This process is called fluorescence and can be used for imaging cancer cells. 3-Bromo-5-nitrobenzoic acid also has potent antiproliferative activity against cancer cells, which may be due to its ability to bind ligands on target proteins in the cell membrane. It can also lead to apoptosis by interfering with the formation of supramolecular complexes or inhibiting protein synthesis.

Formula: C₇H₄BrNO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 246.02 g/mol

Ref: 3D-FB38392

3-Bromo-5-nitrobenzoic acid

CAS: 6307-83-1

Formula: C₇H₄BrNO₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 246.016

Ref: 10-F047913