CAS 63071-12-5

(6-methoxypyridin-2-yl)methanol

Description:

(6-Methoxypyridin-2-yl)methanol is an organic compound characterized by its pyridine ring structure, which is substituted with a methoxy group at the 6-position and a hydroxymethyl group at the 2-position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in polar solvents such as water and alcohols, owing to the presence of the hydroxymethyl group, which can engage in hydrogen bonding. The methoxy group contributes to its overall polarity and can influence its reactivity and interaction with other chemical species. (6-Methoxypyridin-2-yl)methanol may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its structure allows for potential interactions with various biological targets, which could be explored for therapeutic applications. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.

Formula: C₇H₉NO₂

InChI: InChI=1/C7H9NO2/c1-10-7-4-2-3-6(5-9)8-7/h2-4,9H,5H2,1H3

SMILES: COc1cccc(CO)n1

Synonyms:

• 2-Pyridinemethanol, 6-Methoxy-

(6-METHOXY-PYRIDIN-2-YL)-METHANOL

CAS: 63071-12-5

Formula: C₇H₉NO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 139.1519

Ref: IN-DA00EA06

(6-Methoxy-pyridin-2-yl)-methanol

CAS: 63071-12-5

(6-Methoxy-pyridin-2-yl)-methanol

Purity: 97%

Molecular weight: 139.15g/mol

Ref: 54-OR913313

(6-Methoxypyridin-2-yl)methanol

CAS: 63071-12-5

Formula: C₇H₉NO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 139.154

Ref: 10-F218402

(6-Methoxy-pyridin-2-yl)-methanol

CAS: 63071-12-5

Versatile small molecule scaffold

Formula: C₇H₉NO₂

Purity: Min. 95%

Molecular weight: 139.16 g/mol

Ref: 3D-NCA07112