CAS 63076-51-7
:Cyclopentyl-boronic acid
Description:
Cyclopentyl-boronic acid, with the CAS number 63076-51-7, is an organoboron compound characterized by the presence of a boronic acid functional group attached to a cyclopentyl ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its ability to form reversible covalent bonds with diols, making it valuable in various applications, particularly in organic synthesis and medicinal chemistry. Cyclopentyl-boronic acid is often utilized in Suzuki-Miyaura cross-coupling reactions, which are essential for constructing carbon-carbon bonds in the synthesis of complex organic molecules. Additionally, its boronic acid group can participate in various chemical transformations, including the formation of boronate esters. The compound is generally stable under standard conditions but may require careful handling due to its reactivity with moisture and air. Overall, cyclopentyl-boronic acid serves as a versatile building block in the development of pharmaceuticals and agrochemicals.
Formula:C5H11BO2
InChI:InChI=1/C5H11BO2/c7-6(8)5-3-1-2-4-5/h5,7-8H,1-4H2
SMILES:C1CCC(C1)B(O)O
Synonyms:- Cyclopentylboronic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Cyclopentylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C5H11BO2Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:113.95Boronic acid, cyclopentyl-
CAS:Formula:C5H11BO2Purity:97%Color and Shape:SolidMolecular weight:113.9506Cyclopentylboronic acid
CAS:Cyclopentylboronic acidFormula:C5H11BO2Purity:97%Color and Shape: colourless solidMolecular weight:113.95g/molCyclopentylboronic acid, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C5H11BO2Purity:95%Color and Shape:White to pale cream, Crystals or powder or crystalline powderMolecular weight:113.95






