CAS 63084-42-4

(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 2,3,6-trideoxy-3-(formylamino)hexopyranoside

Description:

The chemical substance known as "(1S,3S)-3-acetyl-3,5,12-trihydroxy-10-methoxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracen-1-yl 2,3,6-trideoxy-3-(formylamino)hexopyranoside," with the CAS number 63084-42-4, is a complex organic compound characterized by its intricate molecular structure. It features multiple functional groups, including hydroxyl (-OH), acetyl (-COCH3), methoxy (-OCH3), and formylamino (-NHCHO) groups, which contribute to its reactivity and potential biological activity. The presence of dioxo groups indicates that it may participate in redox reactions. The hexahydrotetracene backbone suggests a polycyclic aromatic structure, which can influence its stability and interactions with other molecules. This compound may exhibit properties such as solubility in organic solvents, potential biological activity, and the ability to form hydrogen bonds due to its hydroxyl groups. Its specific applications and behavior would depend on further studies, including its interactions in biological systems and potential therapeutic uses.

Formula: C₂₈H₂₉NO₁₁

InChI: InChI=1/C28H29NO11/c1-11-23(32)15(29-10-30)7-18(39-11)40-17-9-28(37,12(2)31)8-14-20(17)27(36)22-21(25(14)34)24(33)13-5-4-6-16(38-3)19(13)26(22)35/h4-6,10-11,15,17-18,23,32,34,36-37H,7-9H2,1-3H3,(H,29,30)/t11?,15?,17-,18?,23?,28-/m0/s1

SMILES: CC1C(C(CC(O1)O[C@H]1C[C@@](Cc2c1c(c1c(C(=O)c3cccc(c3C1=O)OC)c2O)O)(C(=O)C)O)N=CO)O

Baumycin C1

CAS: 63084-42-4

Formula: C₂₈H₂₉NO₁₁

Color and Shape: Red Solid

Molecular weight: 555.54

Ref: 4Z-D-4812

Baumycin C1

Controlled Product

CAS: 63084-42-4

Formula: C₂₈H₂₉NO₁₁

Color and Shape: Neat

Molecular weight: 555.53

Ref: TR-B118855

Baumycin C1

CAS: 63084-42-4

Baumycin C1 is an anthracycline-type antibiotic, which is derived from the bacterium *Streptomyces coeruleorubidus*. The mode of action of Baumycin C1 involves intercalating into DNA strands, thereby disrupting the process of DNA synthesis and replication. This intercalation results in the inhibition of topoisomerase II, an enzyme crucial for DNA unwinding, leading to the generation of double-strand breaks and subsequent interruption of cellular proliferation.

Formula: C₂₈H₂₉NO₁₁

Purity: Min. 95%

Molecular weight: 555.5 g/mol

Ref: 3D-NCA08442

Baumycin C1

CAS: 63084-42-4

Formula: C₂₈H₂₉NO₁₁

Molecular weight: 555.54

Ref: ST-EA-CP-D104014

Baumycin C1

CAS: 63084-42-4

Baumycin C1 is an antitumor antibiotic (antibiotic).

Formula: C₂₈H₂₉NO₁₁

Color and Shape: Solid

Molecular weight: 555.53

Ref: TM-TN10742