CymitQuimica logo

CAS 63086-28-2

:

2-[[(4-Methoxyphenyl)methyl]amino]acetonitrile

Description:
2-[[(4-Methoxyphenyl)methyl]amino]acetonitrile, with the CAS number 63086-28-2, is an organic compound characterized by its unique structure that includes a methoxy-substituted phenyl group and an acetonitrile functional group. This compound typically appears as a solid or liquid, depending on its specific formulation and purity. It is known for its potential applications in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals. The presence of the methoxy group enhances its lipophilicity, which can influence its biological activity and solubility in organic solvents. Additionally, the amino group in the structure can participate in hydrogen bonding, affecting its reactivity and interactions with other molecules. As with many organic compounds, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, 2-[[(4-Methoxyphenyl)methyl]amino]acetonitrile is a compound of interest in chemical research and development, particularly in the context of drug discovery and synthesis.
Formula:C10H12N2O
InChI:InChI=1S/C10H12N2O/c1-13-10-4-2-9(3-5-10)8-12-7-6-11/h2-5,12H,7-8H2,1H3
InChI key:InChIKey=YLTXKLKHLKFNLB-UHFFFAOYSA-N
SMILES:C(NCC#N)C1=CC=C(OC)C=C1
Synonyms:
  • 2-((4-Methoxybenzyl)amino)acetonitrile
  • (4-Methoxy-benzylamino)-acetonitrile
  • 2-[[(4-Methoxyphenyl)methyl]amino]acetonitrile
  • Acetonitrile, 2-[[(4-methoxyphenyl)methyl]amino]-
  • Acetonitrile, [[(4-methoxyphenyl)methyl]amino]-
Found 3 products.