CymitQuimica logo

CAS 63088-78-8

:

(2S,5S)-5-hydroxypiperidine-2-carboxylic acid

Description:
(2S,5S)-5-hydroxypiperidine-2-carboxylic acid, also known as L-hydroxyproline, is an amino acid derivative characterized by its piperidine ring structure, which includes a hydroxyl group and a carboxylic acid functional group. This compound is a chiral molecule, existing in two enantiomeric forms, with the (2S,5S) configuration being biologically relevant. It is typically a white to off-white crystalline solid, soluble in water and polar organic solvents, which facilitates its use in various biochemical applications. The presence of the hydroxyl group contributes to its reactivity and ability to participate in hydrogen bonding, influencing its role in protein structure and stability, particularly in collagen synthesis. Additionally, it can serve as a building block in the synthesis of pharmaceuticals and agrochemicals. Its CAS number, 63088-78-8, is a unique identifier that aids in the cataloging and regulation of this compound in chemical databases. Overall, (2S,5S)-5-hydroxypiperidine-2-carboxylic acid is significant in both biological systems and synthetic chemistry.
Formula:C6H11NO3
InChI:InChI=1S/C6H11NO3/c8-4-1-2-5(6(9)10)7-3-4/h4-5,7-8H,1-3H2,(H,9,10)/t4-,5-/m0/s1
InChI key:RKEYKDXXZCICFZ-WHFBIAKZSA-N
SMILES:C1C[C@H](NC[C@H]1O)C(=O)O
Synonyms:
  • (2S,5S)-5-Hydroxy-2-piperidinecarboxylic acid
Found 5 products.