CAS 6309-04-2
:3-[(4-amino-2-ethylpyrimidin-5-yl)methyl]-5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium
Description:
3-[(4-amino-2-ethylpyrimidin-5-yl)methyl]-5-(2-hydroxyethyl)-4-methyl-1,3-thiazol-3-ium, with the CAS number 6309-04-2, is a chemical compound characterized by its complex structure that includes a thiazolium ring, a pyrimidine moiety, and hydroxyethyl and methyl substituents. This compound typically exhibits properties associated with its heterocyclic nature, such as potential solubility in polar solvents due to the presence of hydroxyl groups and the ability to participate in hydrogen bonding. The thiazolium ring contributes to its reactivity, making it a candidate for various chemical reactions, including those involving nucleophiles. Additionally, the amino and ethyl groups on the pyrimidine enhance its biological activity, potentially influencing its role in medicinal chemistry. Overall, this compound's unique structural features suggest it may have applications in pharmaceuticals or as a biochemical probe, although specific biological activities would require further investigation.
Formula:C13H19N4OS
InChI:InChI=1/C13H19N4OS/c1-3-12-15-6-10(13(14)16-12)7-17-8-19-11(4-5-18)9(17)2/h6,8,18H,3-5,7H2,1-2H3,(H2,14,15,16)/q+1
SMILES:CCc1ncc(CN2[CH]SC(=C2C)CCO)c(=N)[nH]1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Thiamine EP Impurity F Bromide HBr
CAS:Formula:C13H19N4OS·Br·HBrColor and Shape:White To Off-White SolidMolecular weight:279.39 79.90 80.91Ethyl Thiamine Bromide Hydrobromide
CAS:Controlled ProductApplications Thiamine (T344185) impurity.
References Warnock, L., et al.: Anal. Biochem., 126, 394 (1982), Royer-Morrot, J., et al.: Eur. J. Clin. Pharmacol., 42, 219 (1992),Formula:C13H19BrN4OS•HBrColor and Shape:NeatMolecular weight:359.298091Ethyl thiamine bromide hydrobromide
CAS:Please enquire for more information about Ethyl thiamine bromide hydrobromide including the price, delivery time and more detailed product information at the technical inquiry form on this pageFormula:C13H19N4OSBr·HBrPurity:Min. 95%Molecular weight:440.2 g/mol



