CAS 6309-16-6
:1-(2-Thienyl)ethylamine
Description:
1-(2-Thienyl)ethylamine, with the CAS number 6309-16-6, is an organic compound characterized by the presence of a thienyl group (a five-membered aromatic ring containing sulfur) attached to an ethylamine moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure includes a two-carbon ethyl chain linked to an amine group, which contributes to its basicity and potential reactivity. The thienyl group imparts unique electronic properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The compound may participate in hydrogen bonding due to the amine functional group, influencing its interactions with other molecules. Additionally, 1-(2-Thienyl)ethylamine can undergo various chemical reactions, such as alkylation and acylation, making it a versatile building block in synthetic organic chemistry. Its specific properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other functional groups in a given reaction context.
Formula:C6H10NS
InChI:InChI=1/C6H9NS/c1-5(7)6-3-2-4-8-6/h2-5H,7H2,1H3/p+1/t5-/m0/s1
Synonyms:- 1H-azepine, hexahydro-2-(3-pyridinyl)-
- 2-(3-Pyridinyl)azepan
- 2-(3-Pyridinyl)azepane
- 2-(Pyridin-3-yl)azepane
- (1R)-1-thiophen-2-ylethanaminium
- (1S)-1-thiophen-2-ylethanaminium
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-(2-Thienyl)ethylamine, tech. 90%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C6H9NSPurity:90%Color and Shape:Liquid, Clear yellowMolecular weight:127.211-(Thiophen-2-yl)ethanamine
CAS:Formula:C6H9NSPurity:97%Color and Shape:LiquidMolecular weight:127.20742-(1-Aminoethyl)thiophene
CAS:2-(1-Aminoethyl)thiophenePurity:99%Color and Shape:LiquidMolecular weight:127.21g/mol



