CAS 6309-98-4
:Avenin
Description:
Avenin is a type of protein classified as a prolamin, primarily found in oats. It is a storage protein that plays a crucial role in the nutritional profile of oats, contributing to their protein content. Avenin is known for its solubility in alcohol-water mixtures, which is characteristic of prolamins. It is also notable for its potential to elicit allergic reactions in some individuals, particularly those with oat allergies or celiac disease, although it is generally considered less immunogenic than gluten from wheat. The protein structure of avenin consists of a high proportion of glutamine and proline, which contributes to its unique properties. In terms of functionality, avenin can influence the texture and stability of food products, making it valuable in various culinary applications. Additionally, avenin's nutritional benefits, including its amino acid profile and potential health benefits, have garnered interest in the context of dietary research. Overall, avenin is an important component of oats, contributing to both their nutritional value and potential allergenic properties.
Formula:C6H14NO5P
InChI:InChI=1S/C6H14NO5P/c1-5(2)12-6(8)7-13(9,10-3)11-4/h5H,1-4H3,(H,7,8,9)
InChI key:InChIKey=XXRYFVCIMARHRS-UHFFFAOYSA-N
SMILES:P(NC(OC(C)C)=O)(OC)(OC)=O
Synonyms:- Carbamic acid, (dimethoxyphosphinyl)-, 1-methylethyl ester
- Carbamic acid, N-(dimethoxyphosphinyl)-, 1-methylethyl ester
- Carbamic acid, phosphono-, isopropyl dimethyl ester
- Carbamic acid, phosphono-, C-isopropyl P,P-dimethyl ester
- Carbamic acid, phosphono-, C-isopropyl dimethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
