CAS 63093-41-4
:ethyl pent-4-ynoate
Description:
Ethyl pent-4-ynoate is an organic compound classified as an alkyne ester, characterized by its distinctive triple bond and ester functional group. It features a five-carbon chain with a triple bond located at the fourth carbon, contributing to its unsaturation and reactivity. The molecular formula of ethyl pent-4-ynoate is C₇H₈O₂, indicating the presence of both carbon and oxygen atoms. This compound typically appears as a colorless liquid with a fruity odor, making it potentially useful in flavor and fragrance applications. Ethyl pent-4-ynoate is soluble in organic solvents and exhibits moderate volatility. Its reactivity is influenced by the presence of the triple bond, which can participate in various chemical reactions, including addition reactions with electrophiles. Additionally, the compound can undergo hydrolysis to form the corresponding carboxylic acid and alcohol. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested. Overall, ethyl pent-4-ynoate is a versatile compound with applications in organic synthesis and the chemical industry.
Formula:C7H10O2
InChI:InChI=1/C7H10O2/c1-3-5-6-7(8)9-4-2/h1H,4-6H2,2H3
SMILES:C#CCCC(=O)OCC
Synonyms:- 4-Pentynoic acid ethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Pentynoic Acid Ethyl Ester
CAS:4-Pentynoic acid ethyl ester (4PE) is a hematological agent that can be used to treat cancer. 4PE inhibits the growth of cancer cells by binding to the histone deacetylase enzyme, which is required for the transcription of genes that are involved in cell division and differentiation. The binding of 4PE to the enzyme causes it to become inactive, leading to inhibition of gene transcription and alteration of cellular metabolism. This results in decreased cell proliferation and an increase in apoptosis.Formula:C7H10O2Purity:Min. 95%Molecular weight:126.15 g/molRef: IN-DA00374H
Discontinued product



