CAS 63094-81-5
:L-asparagine T-butyl ester*hydrochloride
Description:
L-asparagine T-butyl ester hydrochloride is a derivative of the amino acid L-asparagine, where the amino group is protected by a t-butyl ester group, and it exists as a hydrochloride salt. This compound is typically characterized by its white crystalline appearance and is soluble in water and polar organic solvents. It is often used in peptide synthesis and as an intermediate in organic chemistry due to its ability to participate in various reactions, including coupling reactions. The presence of the t-butyl ester group enhances its stability and solubility, making it a useful reagent in biochemical applications. Additionally, the hydrochloride form ensures that the compound remains in a stable ionic state, which is beneficial for storage and handling. As with many amino acid derivatives, it may exhibit biological activity, but specific biological properties would depend on the context of its use. Safety data should be consulted to ensure proper handling and usage in laboratory settings.
Formula:C8H17ClN2O3
InChI:InChI=1/C8H16N2O3.ClH/c1-8(2,3)13-7(12)5(9)4-6(10)11;/h5H,4,9H2,1-3H3,(H2,10,11);1H/t5-;/m0./s1
SMILES:CC(C)(C)OC(=O)[C@H](CC(=N)O)N.Cl
Synonyms:- H-Asn-OtBu.HCl
- L-Asparagine tert-butyl ester hydrochloride
- H-Asn-OBut*HCl
- L-Asn-O-tert-Bu HCl
- tert-butyl L-asparaginate hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
L-Asparagine tert-butyl ester hydrochloride, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C8H17ClN2O3Purity:95%Molecular weight:224.69H-Asn-OtBu · HCl
CAS:Bachem ID: 4000340.
Formula:C8H16N2O3·HClPurity:> 99%Color and Shape:White PowderMolecular weight:224.69L-Asparagine tert-butyl ester hydrochloride
CAS:Formula:C8H16N2O3·HClPurity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:224.69




