CAS 63095-28-3
:15-Methyl-2,5,8,11,14-pentaoxahexadecane
Description:
15-Methyl-2,5,8,11,14-pentaoxahexadecane, with the CAS number 63095-28-3, is a synthetic compound characterized by its long-chain structure that includes five ether linkages (oxa groups) and a branched methyl group. This compound belongs to the class of polyethers, which are known for their flexibility, low toxicity, and good solubility in various organic solvents. The presence of multiple ether linkages contributes to its potential applications in fields such as materials science, pharmaceuticals, and as surfactants. The branched methyl group can influence the compound's physical properties, such as melting and boiling points, as well as its solubility characteristics. Additionally, the molecular structure suggests that it may exhibit unique interactions with other substances, making it of interest for research in polymer chemistry and related areas. Overall, 15-Methyl-2,5,8,11,14-pentaoxahexadecane is a versatile compound with potential applications in various industrial and scientific domains.
Formula:C12H26O5
InChI:InChI=1S/C12H26O5/c1-12(2)17-11-10-16-9-8-15-7-6-14-5-4-13-3/h12H,4-11H2,1-3H3
InChI key:InChIKey=ZZFNGRIOLQBARJ-UHFFFAOYSA-N
SMILES:C(OCCOCCOC)COCCOC(C)C
Synonyms:- 2-[2-[2-[2-(2-Methoxyethoxy)ethoxy]ethoxy]ethoxy]propane
- 2,5,8,11,14-Pentaoxahexadecane, 15-methyl-
- 15-Methyl-2,5,8,11,14-pentaoxahexadecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
