CAS 631-58-3

Thiopropionamide

Description:

Thiopropionamide is an organic compound characterized by the presence of a thiol group (-SH) and an amide functional group (-C(O)NH2) within its structure. It is a colorless to pale yellow liquid or solid, depending on the temperature and purity. The compound is known for its distinctive sulfur-containing moiety, which contributes to its unique chemical reactivity and potential applications in organic synthesis and medicinal chemistry. Thiopropionamide is soluble in polar solvents, such as water and alcohols, due to its ability to form hydrogen bonds. It exhibits properties typical of amides, including the ability to participate in nucleophilic reactions. Additionally, thiopropionamide can act as a precursor for various chemical transformations, making it valuable in the synthesis of other sulfur-containing compounds. Safety precautions should be observed when handling this substance, as it may pose health risks if ingested or inhaled. Overall, thiopropionamide is a versatile compound with significant relevance in both industrial and research settings.

Formula: C₃H₇NS

InChI: InChI=1/C3H7NS/c1-2-3(4)5/h2H2,1H3,(H2,4,5)

SMILES: CCC(=N)S

Synonyms:

• Propanethioamide

Thiopropionamide

CAS: 631-58-3

Formula: C₃H₇NS

Purity: >98.0%(GC)

Color and Shape: White to Yellow to Orange powder to crystal

Molecular weight: 89.16

Ref: 3B-T0669

Thiopropionamide

CAS: 631-58-3

Formula: C₃H₇NS

Purity: 96%

Color and Shape: Solid

Molecular weight: 89.1594

Ref: IN-DA0035P2

Thiopropionamide

CAS: 631-58-3

Thiopropionamide

Purity: 96%

Molecular weight: 89.16g/mol

Ref: 54-OR1015239

Propanethiomide

CAS: 631-58-3

Formula: C₃H₇NS

Molecular weight: 89.16

Ref: 4Z-P-226010

Thiopropionamide

CAS: 631-58-3

Formula: C₃H₇NS

Purity: 97%

Color and Shape: Solid

Molecular weight: 89.16

Ref: 10-F011342