CAS 631-69-6
:beta-Boswellic acid
Description:
Beta-Boswellic acid is a pentacyclic triterpenoid compound primarily derived from the resin of the Boswellia serrata tree, commonly known for its anti-inflammatory and analgesic properties. It is characterized by its molecular formula, which typically includes a series of carbon, hydrogen, and oxygen atoms arranged in a specific structure that contributes to its biological activity. This compound exhibits a range of pharmacological effects, including the inhibition of pro-inflammatory mediators, making it of interest in the treatment of conditions such as arthritis and asthma. Beta-Boswellic acid is also noted for its potential in promoting gastrointestinal health and exhibiting anticancer properties. Its solubility is generally low in water but can be dissolved in organic solvents, which is important for its formulation in various therapeutic applications. Additionally, it is often studied for its safety profile and bioavailability, as these factors influence its effectiveness in clinical settings. Overall, beta-Boswellic acid represents a significant area of research in natural product chemistry and pharmacology.
Formula:C30H48O3
InChI:InChI=1S/C30H48O3/c1-18-10-13-26(3)16-17-28(5)20(24(26)19(18)2)8-9-21-27(4)14-12-23(31)30(7,25(32)33)22(27)11-15-29(21,28)6/h8,18-19,21-24,31H,9-17H2,1-7H3,(H,32,33)/t18-,19+,21-,22-,23-,24+,26-,27-,28-,29-,30-/m1/s1
InChI key:InChIKey=NBGQZFQREPIKMG-PONOSELZSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)([C@](C(O)=O)(C)[C@H](O)CC3)[H])(CC=C4[C@@]2(C)CC[C@]5(C)[C@]4([C@@H](C)[C@H](C)CC5)[H])[H]
Synonyms:- (3Alpha)-3-Hydroxyurs-12-En-24-Oic Acid
- (3α,4β)-3-Hydroxyurs-12-en-23-oic acid
- 3α-Hydroxyurs-12-en-24-oic acid
- Boswellic acid
- Urs-12-en-23-oic acid, 3-hydroxy-, (3alpha,4beta)-
- Urs-12-en-23-oic acid, 3-hydroxy-, (3α,4β)-
- Urs-12-en-24-oic acid, 3α-hydroxy-
- β-Boswellic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
β-Boswellic acid
CAS:beta-Boswellic acid analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C30H48O3Purity:(HPLC) ≥97%Color and Shape:PowderMolecular weight:456.71β-Boswellic acid
CAS:Formula:C30H48O3Purity:≥ 98.0%Color and Shape:White to light yellow powderMolecular weight:456.70β-Boswellic acid
CAS:Beta-boswellic acid and its derivatives (the major constituents of Boswellin) have anti-carcinogenic, anti-tumor, and anti-hyperlipidemic activities. Beta-boswellic acid can significantly enhance neurite outgrowth, branching, and tubulin polymerization dynamics.Formula:C30H48O3Purity:95%~99%Molecular weight:456.711β-Boswellic acid
CAS:β-Boswellic acid (Beta-boswellic acid) and its derivatives (the major constituents of Boswellin) have anti-carcinogenic, anti-tumor, and anti-hyperlipidemicFormula:C30H48O3Purity:99.2% - 99.96%Color and Shape:Off-White SolidMolecular weight:456.70Ref: TM-TN1097
1mg58.00€5mg137.00€10mg212.00€25mg363.00€50mg527.00€100mg747.00€1mL*10mM (DMSO)161.00€Β-boswellic acid
CAS:Carboxylic acid with alcohol functionFormula:C30H48O3Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:456.71beta-Boswellic acid
CAS:Controlled Productbeta-Boswellic acid is a pentacyclic triterpenic acid, which is a natural product derived from the resin of Boswellia species, commonly known as frankincense. This resinous botanical source has been esteemed in traditional medicine for its therapeutic potential. The mode of action of beta-Boswellic acid involves the inhibition of specific enzymes, such as 5-lipoxygenase, which plays a crucial role in the biosynthesis of leukotrienes, potent mediators of inflammation. By modulating this pathway, beta-Boswellic acid exhibits significant anti-inflammatory and analgesic effects.Formula:C30H48O3Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:456.70 g/mol










