CymitQuimica logo

CAS 6310-02-7

:

2-amino-6-chloropyrimidine-4(1H)-thione

Description:
2-Amino-6-chloropyrimidine-4(1H)-thione is a heterocyclic compound characterized by its pyrimidine ring structure, which includes an amino group and a thione functional group. The presence of the chlorine atom at the 6-position contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits properties such as being a solid at room temperature, with moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. The thione group, which is a sulfur-containing functional group, can influence the compound's acidity and reactivity, making it a potential candidate for synthesis in medicinal chemistry and agrochemicals. Additionally, the compound may exhibit biological activity, which is often explored in pharmaceutical research. Its CAS number, 6310-02-7, allows for easy identification and retrieval of information in chemical databases. Overall, 2-amino-6-chloropyrimidine-4(1H)-thione is a versatile compound with significant implications in various fields of chemistry.
Formula:C4H4ClN3S
InChI:InChI=1/C4H4ClN3S/c5-2-1-3(9)8-4(6)7-2/h1H,(H3,6,7,8,9)
SMILES:c1c(Cl)[nH]c(=N)nc1S
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.