CAS 6310-20-9
:4-tert-butyl-3-nitroaniline
Description:
4-tert-butyl-3-nitroaniline is an organic compound characterized by its aromatic amine structure, featuring a nitro group and a tert-butyl substituent on the benzene ring. It has a molecular formula that includes carbon, hydrogen, nitrogen, and oxygen atoms, reflecting its complex structure. This compound typically appears as a solid at room temperature and is known for its yellow to orange color. It is moderately soluble in organic solvents but has limited solubility in water due to its hydrophobic tert-butyl group. The presence of the nitro group contributes to its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitution. Additionally, 4-tert-butyl-3-nitroaniline is used in the synthesis of dyes, pigments, and pharmaceuticals, highlighting its significance in industrial applications. However, like many nitroanilines, it may pose environmental and health risks, necessitating careful handling and disposal. Overall, this compound exemplifies the diverse functionalities of substituted anilines in organic chemistry.
Formula:C10H14N2O2
InChI:InChI=1/C10H14N2O2/c1-10(2,3)8-5-4-7(11)6-9(8)12(13)14/h4-6H,11H2,1-3H3
SMILES:CC(C)(C)c1ccc(cc1N(=O)=O)N
Synonyms:- Benzenamine, 4-(1,1-Dimethylethyl)-3-Nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
