CAS 6310-27-6

3-[(4-chlorophenyl)sulfanyl]propanoate

Description:

3-[(4-Chlorophenyl)sulfanyl]propanoate, with the CAS number 6310-27-6, is an organic compound characterized by the presence of a propanoate group attached to a sulfanyl (thioether) moiety, which is further substituted with a 4-chlorophenyl group. This compound typically exhibits properties associated with both the propanoate ester functional group and the aromatic chlorophenyl group. It is likely to be a solid at room temperature, with moderate solubility in organic solvents due to its hydrophobic aromatic component. The presence of the chlorophenyl group may impart biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the sulfanyl group can influence the compound's reactivity and interaction with other chemical species. As with many organic compounds, safety precautions should be observed when handling this substance, as it may pose health risks or environmental hazards. Overall, 3-[(4-chlorophenyl)sulfanyl]propanoate is a compound of interest in various chemical applications, particularly in synthetic organic chemistry.

Formula: C₉H₈ClO₂S

InChI: InChI=1/C9H9ClO2S/c10-7-1-3-8(4-2-7)13-6-5-9(11)12/h1-4H,5-6H2,(H,11,12)/p-1

SMILES: c1cc(ccc1Cl)SCCC(=O)[O-]

3-[(4-chlorophenyl)thio]propanoic acid

CAS: 6310-27-6

Formula: C₉H₉ClO₂S

Purity: 95.0%

Molecular weight: 216.68

Ref: 10-F367715