CAS 6310-41-4

N-[2-(methylsulfanyl)phenyl]acetamide

Description:

N-[2-(methylsulfanyl)phenyl]acetamide, with the CAS number 6310-41-4, is an organic compound characterized by its amide functional group and a methylsulfanyl substituent on a phenyl ring. This compound features a phenyl group that is substituted at the ortho position with a methylsulfanyl group, which contributes to its unique chemical properties. The presence of the acetamide moiety indicates that it can participate in hydrogen bonding, influencing its solubility and reactivity. Typically, compounds of this nature may exhibit biological activity, making them of interest in pharmaceutical research. The methylsulfanyl group can also affect the electronic properties of the molecule, potentially influencing its interactions with biological targets. In terms of physical properties, such compounds often have moderate melting and boiling points, and their solubility can vary depending on the solvent used. Overall, N-[2-(methylsulfanyl)phenyl]acetamide represents a class of compounds that may have diverse applications in medicinal chemistry and material science.

Formula: C₉H₁₁NOS

InChI: InChI=1/C9H11NOS/c1-7(11)10-8-5-3-4-6-9(8)12-2/h3-6H,1-2H3,(H,10,11)

SMILES: CC(=Nc1ccccc1SC)O

NSC-41589

CAS: 6310-41-4

Formula: C₉H₁₁NOS

Purity: 98%

Color and Shape: Solid

Molecular weight: 181.2547

Ref: IN-DA00ECED

NSC-41589

CAS: 6310-41-4

NSC-41589

Purity: ≥98%

Molecular weight: 181.25g/mol

Ref: 54-BUP02637

2'-(Methylsulphanyl)acetanilide

CAS: 6310-41-4

2'-(Methylsulphanyl)acetanilide

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 181.25g/mol

Ref: 54-OR41169

NSC-41589

CAS: 6310-41-4

NSC-41589 is N-[2-(methylsulfanyl) phenyl]acetamide.

Formula: C₉H₁₁NOS

Purity: 98.59% - 98.76%

Color and Shape: Solid

Molecular weight: 181.25

Ref: TM-T2031