CAS 6311-35-9
:6-Bromo-3-pyridinecarboxylic acid
Description:
6-Bromo-3-pyridinecarboxylic acid is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 6-position and a carboxylic acid functional group at the 3-position contributes to its unique chemical properties. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the carboxylic acid group. It exhibits acidic behavior due to the carboxylic acid moiety, which can donate a proton in solution. The bromine substituent can influence the compound's reactivity, making it useful in various chemical syntheses and applications, including pharmaceuticals and agrochemicals. Additionally, 6-Bromo-3-pyridinecarboxylic acid can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Safety precautions should be observed when handling this compound, as with many halogenated and acidic substances.
Formula:C6H3BrNO2
InChI:InChI=1/C6H4BrNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3H,(H,9,10)/p-1
SMILES:c1cc(Br)ncc1C(=O)[O-]
Synonyms:- 6-Bromonicotinic Acid
- 6-Bromo Nicotinic Acid
- 3-Pyridinecarboxylic acid, 6-bromo-
- 6-Bromopyridine-3-Carboxylic Acid
- 6-Bromopyridine-3-Carboxylate
- 2-Bromo Nicotinic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
6-Bromonicotinic Acid
CAS:Formula:C6H4BrNO2Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:202.016-Bromonicotinic acid
CAS:6-Bromonicotinic acidFormula:C6H4BrNO2Purity:≥95%Color and Shape: silvery white flakesMolecular weight:202.01g/mol6-Bromonicotinic acid
CAS:Formula:C6H4BrNO2Purity:≥ 98.0%Color and Shape:White to tan powder or solidMolecular weight:202.016-Bromonicotinic acid
CAS:<p>The chemical compound 6-Bromonicotinic acid belongs to the class of bromonicotinic acids. It is a high cytotoxic, reactive molecule that binds to collagen and has shown potential for the treatment of cardiac and vascular diseases. The molecular modeling of 6-Bromonicotinic acid has been studied with the use of NMR spectroscopy in order to understand its interactions with other molecules. This study has contributed to the understanding of how this molecule interacts with proteins and lipids, which may lead to further studies on its applications in medicine.</p>Formula:C6H4BrNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:202.01 g/mol
