CymitQuimica logo

CAS 6311-60-0

:

1,3-dibromo-5-nitrobenzene

Description:
1,3-Dibromo-5-nitrobenzene is an aromatic compound characterized by the presence of two bromine atoms and one nitro group attached to a benzene ring. The bromine substituents are located at the 1 and 3 positions, while the nitro group is positioned at the 5 position, making it a derivative of nitrobenzene. This compound typically appears as a yellow to orange solid and is known for its relatively low solubility in water, but it is soluble in organic solvents such as acetone and ethanol. It exhibits notable chemical reactivity due to the presence of the electron-withdrawing nitro group, which can influence electrophilic substitution reactions. Additionally, the bromine atoms can participate in nucleophilic substitution reactions, making this compound useful in various synthetic applications in organic chemistry. Safety precautions should be taken when handling this substance, as it may pose health risks, including potential toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any risks associated with its use.
Formula:C6H3Br2NO2
InChI:InChI=1/C6H3Br2NO2/c7-4-1-5(8)3-6(2-4)9(10)11/h1-3H
InChI key:ZWBHGBWABMAWOV-UHFFFAOYSA-N
SMILES:c1c(cc(cc1Br)N(=O)=O)Br
Synonyms:
  • Benzene, 1,3-Dibromo-5-Nitro-
  • 3,5-Dibromonitro Benzene
Found 5 products.