CAS 6311-68-8
:4-oxo-4-phenoxybutanoic acid
Description:
4-Oxo-4-phenoxybutanoic acid, with the CAS number 6311-68-8, is an organic compound characterized by its functional groups, including a carboxylic acid and a ketone. This compound features a butanoic acid backbone, which is substituted at the fourth carbon with a phenoxy group, contributing to its unique properties. It typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound may exhibit acidic behavior, allowing it to participate in various chemical reactions, such as esterification or amidation. Its phenoxy substitution can influence its reactivity and biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the presence of the ketone group may impart specific reactivity patterns, such as susceptibility to nucleophilic attack. Overall, 4-oxo-4-phenoxybutanoic acid is a versatile compound with potential applications in synthetic chemistry and material science.
Formula:C10H10O4
InChI:InChI=1/C10H10O4/c11-9(12)6-7-10(13)14-8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12)
SMILES:c1ccc(cc1)OC(=O)CCC(=O)O
Synonyms:- Butanedioic Acid, Monophenyl Ester
- 4-Oxo-4-phenoxybutanoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Monophenyl succinate
CAS:<p>Monophenyl succinate is an organic compound that is a derivative of succinic acid. It contains a hydroxyl group, which reacts with hydrogen chloride to form a cross-linking agent. The diameters of the particles are between 1 and 100 nm. Monophenyl succinate can be used as a cross-linking agent in polymers and coatings, as well as an antihypertensive drug. The hydroxy group on the monophenyl group has ester linkages with the methyl and ethoxycarbonyl groups on the phenyl group. This compound also has methoxy groups and chlorine atoms attached to it. The reaction products of this compound are hydrogen chloride, hydroxyl group, and diameter.</p>Formula:C10H10O4Purity:Min. 95%Molecular weight:194.18 g/mol
