CAS 63111-79-5

5-chloroimidazo[1,2-a]pyridine

Description:

5-Chloroimidazo[1,2-a]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, with a chlorine substituent at the 5-position of the imidazole ring. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It has notable biological activity, often studied for its potential as a pharmacological agent, particularly in the context of medicinal chemistry. The presence of the chlorine atom can influence its reactivity and interaction with biological targets, making it a subject of interest in drug development. The compound's structure allows for various substitution reactions, which can be exploited to modify its properties for specific applications. Additionally, 5-chloroimidazo[1,2-a]pyridine may exhibit fluorescence properties, making it useful in certain analytical applications. Its molecular weight and specific physical properties can vary based on the conditions under which it is synthesized or stored. Overall, this compound represents a significant class of heterocycles with diverse applications in chemistry and pharmacology.

Formula: C₇H₅ClN₂

InChI: InChI=1/C7H5ClN2/c8-6-2-1-3-7-9-4-5-10(6)7/h1-5H

SMILES: c1cc(Cl)n2ccnc2c1

Synonyms:

• Imidazo[1,2-A]Pyridine, 5-Chloro-
• 5-Chloroimidazo[1,2-a]Pyridine

5-Chloroimidazo[1,2-a]pyridine

CAS: 63111-79-5

Formula: C₇H₅ClN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 152.5810

Ref: IN-DA00EJBJ

5-Chloroimidazo[1,2-a]pyridine

CAS: 63111-79-5

5-Chloroimidazo[1,2-a]pyridine

Purity: 98%

Molecular weight: 152.58g/mol

Ref: 54-OR301061

5-Chloroimidazo[1,2-a]pyridine

CAS: 63111-79-5

Formula: C₇H₅ClN₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 152.58

Ref: 10-F225133