CAS 63119-27-7
:Anitrazafen
Description:
Anitrazafen, with the CAS number 63119-27-7, is a chemical compound primarily recognized for its application as a pesticide, particularly in agricultural settings. It belongs to the class of compounds known as anilines, which are characterized by the presence of an amino group attached to an aromatic ring. Anitrazafen exhibits properties that allow it to act as a herbicide, targeting specific plant growth processes. Its mode of action typically involves the inhibition of photosynthesis or interference with plant hormone regulation, leading to the suppression of unwanted vegetation. The compound is generally considered to have low to moderate toxicity to non-target organisms, although safety measures are recommended during handling and application to minimize environmental impact. Additionally, Anitrazafen's stability and solubility characteristics can vary, influencing its effectiveness and persistence in different environmental conditions. As with any chemical substance, proper regulatory compliance and safety protocols are essential when using Anitrazafen in agricultural practices.
Formula:C18H17N3O2
InChI:InChI=1S/C18H17N3O2/c1-12-19-17(13-4-8-15(22-2)9-5-13)18(21-20-12)14-6-10-16(23-3)11-7-14/h4-11H,1-3H3
InChI key:InChIKey=HDNJXZZJFPCFHG-UHFFFAOYSA-N
SMILES:CC=1N=C(C(=NN1)C2=CC=C(OC)C=C2)C3=CC=C(OC)C=C3
Synonyms:- 1,2,4-Triazine, 5,6-bis(4-methoxyphenyl)-3-methyl-
- 5,6-Bis(4-Methoxyphenyl)-3-Methyl-1,2,4-Triazine
- 5,6-Bis(p-methoxyphenyl)-3-methyl-1,2,4-triazine
- 5,6-Bis(p-methoxyphenyl)-3-methyl-as-triazine
- Anitrazafen [USAN:INN]
- Anitrazafene
- Anitrazafene [INN-French]
- Anitrazafeno
- Anitrazafeno [INN-Spanish]
- Anitrazafenum
- Anitrazafenum [INN-Latin]
- Ly 122512
- NSC 336394
- Unii-2Y065P7Myr
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Anitrazafen
CAS:Antrazafen is an antibacterial drug that belongs to the class of fatty acids. It is used as a diagnostic agent to identify damaged cardiac tissue, and has been shown to have biological properties that can be used in autoimmune diseases. Antrazafen inhibits the production of inflammatory bowel disease by preventing activation of effector proteins, which are proteins that are involved in the immune response. This drug also prevents chronic arthritis by inhibiting glycosidic bonds. The biocompatible polymer coating on antrazafen makes it suitable for use in humans with damaged tissue or joints.
Formula:C18H17N3O2Purity:Min. 95%Molecular weight:307.3 g/molAnitrazafen
CAS:Anitrazafen is a locally effective anti-inflammatory agent that has been shown to have COX-2 inhibitor activity.Formula:C18H17N3O2Purity:98%Color and Shape:SolidMolecular weight:307.35



