CAS 6312-12-5
:1-(2-fluorobenzyl)-1-[3-(1H-imidazol-1-yl)propyl]-3-phenylurea
Description:
1-(2-Fluorobenzyl)-1-[3-(1H-imidazol-1-yl)propyl]-3-phenylurea, with the CAS number 6312-12-5, is a chemical compound that belongs to the class of ureas. This compound features a complex structure characterized by the presence of a fluorobenzyl group, an imidazole moiety, and a phenyl group, which contribute to its potential biological activity. It is typically a white to off-white solid, and its solubility can vary depending on the solvent used. The presence of the imidazole ring suggests potential interactions with biological targets, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The fluorine atom may enhance lipophilicity and influence the compound's pharmacokinetic properties. As with many urea derivatives, it may exhibit various biological activities, including anti-inflammatory or anti-cancer properties, although specific activities would depend on further empirical studies. Proper handling and safety measures should be observed due to its chemical nature and potential biological effects.
Formula:C20H21FN4O
InChI:InChI=1/C20H21FN4O/c21-19-10-5-4-7-17(19)15-25(13-6-12-24-14-11-22-16-24)20(26)23-18-8-2-1-3-9-18/h1-5,7-11,14,16H,6,12-13,15H2,(H,23,26)
SMILES:c1ccc(cc1)N=C(N(CCCn1ccnc1)Cc1ccccc1F)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.