CAS 6312-48-7

2-chloro-3-(4-methylpiperazin-1-yl)naphthalene-1,4-dione

Description:

2-Chloro-3-(4-methylpiperazin-1-yl)naphthalene-1,4-dione, with the CAS number 6312-48-7, is a synthetic organic compound characterized by its naphthalene backbone substituted with a chlorine atom and a piperazine moiety. This compound typically exhibits a yellow to orange color due to the presence of the naphthoquinone structure, which is known for its ability to undergo redox reactions. The chlorine substituent enhances its reactivity, while the piperazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is likely to be soluble in organic solvents and may have limited solubility in water due to its hydrophobic naphthalene core. Its structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting various biological pathways. Additionally, the presence of the piperazine group may influence its pharmacokinetic properties, such as absorption and distribution in biological systems. Safety and handling precautions should be observed, as with many chemical substances, due to potential toxicity or reactivity.

Formula: C₁₅H₁₅ClN₂O₂

InChI: InChI=1/C15H15ClN2O2/c1-17-6-8-18(9-7-17)13-12(16)14(19)10-4-2-3-5-11(10)15(13)20/h2-5H,6-9H2,1H3

SMILES: CN1CCN(CC1)C1=C(C(=O)c2ccccc2C1=O)Cl

Synonyms:

• 1,4-Naphthalenedione, 2-chloro-3-(4-methyl-1-piperazinyl)-
• 2-Chloro-3-(4-methylpiperazin-1-yl)-1,4-naphthoquinone

2-Chloro-3-(4-methylpiperazin-1-yl)-1,4-dihydronaphthalene-1,4-dione

CAS: 6312-48-7

2-Chloro-3-(4-methylpiperazin-1-yl)-1,4-dihydronaphthalene-1,4-dione

Purity: tech

Molecular weight: 290.74g/mol

Ref: 54-OR32264