CAS 6312-73-8
:6-Amino-5-bromo-2,4(1H,3H)-pyrimidinedione
Description:
6-Amino-5-bromo-2,4(1H,3H)-pyrimidinedione, with the CAS number 6312-73-8, is a heterocyclic organic compound characterized by a pyrimidine ring structure that contains both amino and bromo substituents. This compound features a 2,4-dione functionality, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the amino group enhances its solubility in polar solvents and allows for further derivatization, making it useful in medicinal chemistry and as an intermediate in the synthesis of pharmaceuticals. The bromine atom introduces a halogen, which can participate in nucleophilic substitution reactions, expanding its utility in organic synthesis. Additionally, the compound may exhibit biological activity, making it of interest for research in drug development. Its stability and reactivity can be influenced by the surrounding functional groups and the overall molecular environment. As with many pyrimidine derivatives, it may also exhibit properties such as antimicrobial or antitumor activity, warranting further investigation into its potential applications.
Formula:C4H4BrN3O2
InChI:InChI=1S/C4H4BrN3O2/c5-1-2(6)7-4(10)8-3(1)9/h(H4,6,7,8,9,10)
InChI key:InChIKey=FSLBEEVCUZFKRL-UHFFFAOYSA-N
SMILES:BrC1=C(N)NC(=O)NC1=O
Synonyms:- 1-Cyclopentyl-1-(2-Fluorobenzyl)-3-Hexylthiourea
- 5-Bromo-6-aminouracil
- 6-Amino-5-bromo-2,4(1H,3H)-pyrimidinedione
- 6-Amino-5-bromouracil
- 6-amino-5-bromopyrimidine-2,4(1H,3H)-dione
- NSC 27652
- NSC 40394
- Uracil, 6-amino-5-bromo-
- 2,4(1H,3H)-Pyrimidinedione, 6-amino-5-bromo-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Amino-5-bromo-1,2,3,4-tetrahydropyrimidine-2,4-dione
CAS:6-Amino-5-bromo-1,2,3,4-tetrahydropyrimidine-2,4-dioneFormula:C4H4BrN3O2Purity:≥95%Color and Shape: light lemon/yellow. wooly. lumpy powderMolecular weight:206.00g/mol6-Amino-5-bromopyrimidine-2,4(1H,3H)-dione
CAS:<p>6-Amino-5-bromopyrimidine-2,4(1H,3H)-dione (6ABPD) is a purine derivative that functions as an inhibitor of phosphorylase kinase. It has been shown to inhibit tumor growth in vivo and in vitro and is used as a therapeutic agent for the treatment of cancer. 6ABPD inhibits the production of phosphorylase kinase by binding to the enzyme's active site with noncompetitive inhibition. Inhibition of phosphorylase kinase leads to a decrease in the levels of ATP and thus decreases the availability of substrates for tumor cell growth and proliferation. 6ABPD also binds to thymidine kinase and inhibits its activity, which may account for some of its antitumor effects.</p>Formula:C4H4BrN3O2Purity:Min. 95%Color and Shape:PowderMolecular weight:206 g/mol



