CymitQuimica logo

CAS 6313-36-6

:

S-benzyl hydrogen sulfurothioate

Description:
S-benzyl hydrogen sulfurothioate, with the CAS number 6313-36-6, is an organosulfur compound characterized by the presence of both a benzyl group and a hydrogen sulfurothioate functional group. This compound typically appears as a colorless to pale yellow liquid and is known for its distinctive odor. It is soluble in organic solvents but has limited solubility in water. The presence of the sulfurothioate group imparts unique reactivity, making it useful in various chemical synthesis applications, particularly in the formation of thioester linkages. S-benzyl hydrogen sulfurothioate can participate in nucleophilic substitution reactions and may serve as a reagent in organic synthesis, including the preparation of other sulfur-containing compounds. Additionally, it may exhibit biological activity, although specific biological properties can vary based on the context of its use. As with many organosulfur compounds, handling precautions should be observed due to potential toxicity and reactivity.
Formula:C7H8O3S2
InChI:InChI=1/C7H8O3S2/c8-12(9,10)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H,8,9,10)
SMILES:c1ccc(cc1)CSS(=O)(=O)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Benzylthiosulfuric Acid Sodium Salt

    Controlled Product
    CAS:
    Formula:C7H7NaO3S2
    Color and Shape:Neat
    Molecular weight:226.249

    Ref: TR-B313030

    2500mg
    1,022.00€