CAS 6313-54-8
:2-Chloroisonicotinic acid
Description:
2-Chloroisonicotinic acid, with the CAS number 6313-54-8, is a heterocyclic organic compound that belongs to the class of chlorinated pyridine derivatives. It features a pyridine ring substituted with a carboxylic acid group and a chlorine atom at the 2-position. This compound is typically characterized by its solid state at room temperature, exhibiting moderate solubility in polar solvents such as water and alcohols, while being less soluble in non-polar solvents. The presence of both the carboxylic acid and the chlorine substituent contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, 2-chloroisonicotinic acid may exhibit biological activity, which can be explored for potential applications in medicinal chemistry. Its structural features also allow for various chemical modifications, enhancing its utility in research and industrial applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C6H4ClNO2
InChI:InChI=1S/C6H4ClNO2/c7-5-3-4(6(9)10)1-2-8-5/h1-3H,(H,9,10)
InChI key:InChIKey=QXCOHSRHFCHCHN-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(Cl)N=CC1
Synonyms:- 2-Chloro Isonicotinic Acid
- 2-Chloro-4-pyridinecarboxylic acid
- 2-Chloroisonicotinic acid
- 2-Chloropyridine-4-Carboxylate
- 4-Pyridinecarboxylic acid, 2-chloro-
- 6-Chloroisonicotinic acid
- Isonicotinic acid, 2-chloro-
- NSC 40139
- 2-Chloropyridine-4-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-Chloroisonicotinic Acid
CAS:Formula:C6H4ClNO2Purity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:157.552-Chloroisonicotinic acid
CAS:Formula:C6H4ClNO2Purity:98%Color and Shape:SolidMolecular weight:157.5545Ref: IN-DA003GU2
5g20.00€10g27.00€25g25.00€50g47.00€5kgTo inquire100g65.00€10kgTo inquire250g101.00€25kgTo inquire500g162.00€2-Chloroisonicotinic acid
CAS:2-Chloroisonicotinic acidFormula:C6H4ClNO2Purity:≥95%Color and Shape: off-white powderMolecular weight:157.55g/mol2-Chloropyridine-4-carboxylic acid
CAS:Formula:C6H4ClNO2Purity:≥ 99.0%Color and Shape:White to off-white crystalline powderMolecular weight:157.562-Chloroisonicotinic acid
CAS:2-Chloroisonicotinic acid is a halogenated derivative of isonicotinic acid where a chlorine atom is substituted at the 2-position of the pyridine ring (next to the carboxylic acid group).Formula:C6H4ClNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:157.55 g/mol2-Chloroisonicotinic acid
CAS:Formula:C6H4ClNO2Purity:97%Color and Shape:Solid, Crystalline PowderMolecular weight:157.552-Chloroisonicotinic Acid
CAS:Controlled ProductApplications 2-Chloroisonicotinic Acid is a derivative of Isonicotinic Acid (I821760) and is used as a reagent in the synthesis of (phenylmorpholinyl)pyrimidinones as selective and orally active glycogen synthase kinase-3β inhibitors.
References Fukunaga, K., et al.: Bioorg. Med. Chem. Lett., 23, 6933 (2013)Formula:C6H4ClNO2Color and Shape:NeatMolecular weight:157.55






