CAS 63136-17-4
:4-Hydroxy-8-(1-methylethyl)-3-quinolinecarboxylic acid
Description:
4-Hydroxy-8-(1-methylethyl)-3-quinolinecarboxylic acid, identified by its CAS number 63136-17-4, is a chemical compound belonging to the quinoline family. This substance features a quinoline core structure, which is characterized by a fused bicyclic system containing a benzene ring and a pyridine ring. The presence of a hydroxyl group (-OH) at the 4-position and a carboxylic acid group (-COOH) at the 3-position contributes to its acidic properties and potential for hydrogen bonding. The isopropyl group at the 8-position enhances its hydrophobic characteristics, influencing its solubility and reactivity. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of antimicrobial or anti-inflammatory agents. Its unique structural features allow for various interactions in biological systems, which can be explored for therapeutic applications. As with many quinoline derivatives, it may also participate in complexation with metal ions, further expanding its potential utility in coordination chemistry.
Formula:C13H13NO3
InChI:InChI=1S/C13H13NO3/c1-7(2)8-4-3-5-9-11(8)14-6-10(12(9)15)13(16)17/h3-7H,1-2H3,(H,14,15)(H,16,17)
InChI key:InChIKey=KGDOGYITTVCUJA-UHFFFAOYSA-N
SMILES:C(C)(C)C=1C2=C(C(O)=C(C(O)=O)C=N2)C=CC1
Synonyms:- 4-Hydroxy-8-(1-methylethyl)-3-quinolinecarboxylic acid
- 3-Quinolinecarboxylic acid, 4-hydroxy-8-(1-methylethyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
4-Hydroxy-8-(propan-2-yl)quinoline-3-carboxylic acid
CAS:4-Hydroxy-8-(propan-2-yl)quinoline-3-carboxylic acid (4HPCA) is a small molecule that binds to the epidermal growth factor receptor (EGFR). EGFR is a transmembrane protein that is found on the surface of cells. 4HPCA enhances EGFR signaling and induces cellular responses, such as cell proliferation, differentiation, and migration. Binding of 4HPCA to EGFR causes a conformational change in the receptor that activates downstream signaling pathways. This leads to the activation of genes involved in cell proliferation, differentiation, and migration. 4HPCA has been shown to inhibit tumor growth and reduce cancer markers in preclinical models of cancer.Formula:C13H13NO3Purity:Min. 95%Molecular weight:231.25 g/mol
