CAS 6314-70-1
:4-(cyclohexylsulfamoyl)benzoic acid
Description:
4-(Cyclohexylsulfamoyl)benzoic acid, with the CAS number 6314-70-1, is an organic compound characterized by the presence of a benzoic acid moiety substituted with a cyclohexylsulfamoyl group. This compound typically exhibits properties associated with both aromatic and sulfonamide functionalities, which can influence its solubility, reactivity, and biological activity. The cyclohexyl group contributes to its hydrophobic characteristics, while the sulfamoyl group can enhance its interaction with biological targets, potentially making it useful in medicinal chemistry. The presence of the carboxylic acid functional group suggests that it can participate in acid-base reactions and may form salts or esters. Additionally, the compound's structure may allow for hydrogen bonding, affecting its physical properties such as melting point and solubility in various solvents. Overall, 4-(cyclohexylsulfamoyl)benzoic acid is of interest in research contexts, particularly in the development of pharmaceuticals or agrochemicals, due to its unique structural features and potential applications.
Formula:C13H17NO4S
InChI:InChI=1/C13H17NO4S/c15-13(16)10-6-8-12(9-7-10)19(17,18)14-11-4-2-1-3-5-11/h6-9,11,14H,1-5H2,(H,15,16)
SMILES:C1CCC(CC1)NS(=O)(=O)c1ccc(cc1)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
NSC23005
CAS:<p>NSC23005 sodium is a p18INK inhibitor with potently promoted hematopoietic stem cell (HSC) expansion (ED50: 5.21 nM).</p>Formula:C13H17NO4SPurity:>99.99%Color and Shape:SolidMolecular weight:283.34NSC23005
CAS:NSC23005 is a drug that has been shown to have a variety of functions, including the inhibition of kinases and the induction of cell death. It is also active against cells with chromosomal deficiencies, such as cells from patients with Down's syndrome. NSC23005 has been shown to increase the efficiency of stem cells in pluripotent stem cells by preventing damage and promoting cell cycle progression. The mechanisms by which NSC23005 induces cell death are not well understood, but it may be due to its ability to inhibit cyclin-dependent kinases.Formula:C13H17NO4SPurity:Min. 95%Molecular weight:283.35 g/mol



