CAS 6315-19-1
:6-methylnaphthalene-1-carboxylic acid
Description:
6-Methylnaphthalene-1-carboxylic acid is an aromatic carboxylic acid characterized by its naphthalene structure, which consists of two fused benzene rings. The presence of a methyl group at the 6-position and a carboxylic acid functional group at the 1-position contributes to its unique chemical properties. This compound typically appears as a solid at room temperature and is sparingly soluble in water, but more soluble in organic solvents such as ethanol and ether. It exhibits typical acid behavior, capable of donating a proton due to its carboxylic acid group. The compound may participate in various chemical reactions, including esterification and acylation, making it useful in organic synthesis. Additionally, its aromatic nature allows for electrophilic substitution reactions. 6-Methylnaphthalene-1-carboxylic acid may also have applications in the synthesis of dyes, pharmaceuticals, and other organic compounds. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H10O2
InChI:InChI=1/C12H10O2/c1-8-5-6-10-9(7-8)3-2-4-11(10)12(13)14/h2-7H,1H3,(H,13,14)
SMILES:Cc1ccc2c(cccc2C(=O)O)c1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
6-Methylnaphthalene-1-carboxylic acid
CAS:6-Methylnaphthalene-1-carboxylic acidPurity:95%Molecular weight:186.21g/mol6-Methylnaphthalene-1-carboxylic acid
CAS:6-Methylnaphthalene-1-carboxylic acid can be used as a raw material to synthesize medicines. It is a sesquiterpenoid and has been shown to react with benzene in the Friedel-Crafts reaction to form anisole. 6-Methylnaphthalene-1-carboxylic acid also reacts with chlorobenzene in the presence of aluminum chloride or aluminum to form 2-furoic acid. 6-Methylnaphthalene-1-carboxylic acid reacts with chloride to produce benzenes.Formula:C12H10O2Purity:Min. 95%Molecular weight:186.21 g/mol



