CAS 6315-20-4
:m-Methylbenzylsuccinic acid
Description:
m-Methylbenzylsuccinic acid, with the CAS number 6315-20-4, is an organic compound characterized by its structure, which includes a succinic acid backbone substituted with a methylbenzyl group at the meta position. This compound typically appears as a white to off-white crystalline solid. It is soluble in organic solvents, such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic component. The presence of both carboxylic acid groups and an aromatic ring contributes to its potential reactivity, allowing it to participate in various chemical reactions, including esterification and amidation. m-Methylbenzylsuccinic acid may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Its melting point and boiling point can vary based on purity and specific conditions. As with many organic acids, it may exhibit acidic properties, influencing its behavior in different pH environments. Proper handling and storage are essential due to its chemical nature, and safety data sheets should be consulted for specific safety and handling guidelines.
Formula:C12H14O4
InChI:InChI=1S/C12H14O4/c1-8-3-2-4-9(5-8)6-10(12(15)16)7-11(13)14/h2-5,10H,6-7H2,1H3,(H,13,14)(H,15,16)
InChI key:InChIKey=OHQFGTDAUDLCBG-UHFFFAOYSA-N
SMILES:C(C(CC(O)=O)C(O)=O)C1=CC(C)=CC=C1
Synonyms:- 2-(3-Methyl-benzyl)-succinic acid
- 2-(3-Methylbenzyl)succinic acid
- 2-[(3-Methylphenyl)methyl]butanedioic acid
- Butanedioic acid, 2-[(3-methylphenyl)methyl]-
- Butanedioic acid, [(3-methylphenyl)methyl]-
- NSC 20718
- Succinic acid, (m-methylbenzyl)-
- m-Methylbenzylsuccinic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
3-Methylbenzylsuccinic Acid
CAS:Controlled ProductFormula:C12H14O4Color and Shape:NeatMolecular weight:222.2372-(3-Methylbenzyl)succinic acid
CAS:<p>2-(3-Methylbenzyl)succinic acid is a sulfate metabolite that has been shown to regulate the activity of sulfate-reducing bacteria. It was first identified as a major metabolite in incubations with benzylsuccinic acid and xylene. The isomers of 2-(3-methylbenzyl)succinic acid are benzoate and hydroxyphthalide. The geochemical significance of this compound is not yet known, but it may signify the presence of microbial metabolism in the environment. The compound can be found at nanomolar concentrations in natural environments and has been shown to inhibit microbial growth by mechanisms that remain unclear.</p>Formula:C12H14O4Purity:Min. 95%Molecular weight:222.24 g/mol

