CAS 63155-43-1

(4,6-dichloropyrimidin-2-yl)acetonitrile

Description:

(4,6-Dichloropyrimidin-2-yl)acetonitrile is a chemical compound characterized by its pyrimidine ring structure, which features two chlorine substituents at the 4 and 6 positions and a cyano group (-C≡N) attached to an acetic acid derivative. This compound typically appears as a solid or crystalline substance and is known for its role in organic synthesis and pharmaceutical applications. It exhibits moderate polarity due to the presence of the cyano group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The dichlorinated pyrimidine moiety contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry. Additionally, its solubility characteristics may vary depending on the solvent, and it is generally handled with care due to the presence of halogen atoms, which can pose environmental and health risks. Overall, (4,6-dichloropyrimidin-2-yl)acetonitrile is a versatile compound with significant implications in chemical research and development.

Formula: C₆H₃Cl₂N₃

InChI: InChI=1/C6H3Cl2N3/c7-4-3-5(8)11-6(10-4)1-2-9/h3H,1H2

SMILES: C(C#N)c1nc(cc(Cl)n1)Cl

2-(4,6-Dichloropyrimidin-2-yl)acetonitrile

CAS: 63155-43-1

Formula: C₆H₃Cl₂N₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.0141

Ref: IN-DA0036YY

2-(4,6-Dichloropyrimidin-2-yl)acetonitrile

CAS: 63155-43-1

2-(4,6-Dichloropyrimidin-2-yl)acetonitrile

Purity: 95%

Molecular weight: 188.01g/mol

Ref: 54-OR95133

2-(4,6-Dichloropyrimidin-2-yl)acetonitrile

CAS: 63155-43-1

Formula: C₆H₃Cl₂N₃

Purity: 98%

Molecular weight: 188.01

Ref: 10-F092767