CAS 63169-61-9
:2-methylpentanoic anhydride
Description:
2-Methylpentanoic anhydride, with the CAS number 63169-61-9, is an organic compound characterized by its anhydride functional group derived from 2-methylpentanoic acid. This compound typically appears as a colorless to pale yellow liquid and has a distinctive odor. It is known for its reactivity, particularly in condensation reactions, where it can react with alcohols and amines to form esters and amides, respectively. The presence of the anhydride group makes it a useful intermediate in organic synthesis, particularly in the production of various chemical derivatives. 2-Methylpentanoic anhydride is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. Safety precautions should be taken when handling this compound, as it may cause irritation to the skin, eyes, and respiratory system. Proper storage in a cool, dry place away from incompatible materials is essential to maintain its stability and prevent unwanted reactions.
Formula:C12H22O3
InChI:InChI=1/C12H22O3/c1-5-7-9(3)11(13)15-12(14)10(4)8-6-2/h9-10H,5-8H2,1-4H3
SMILES:CCCC(C)C(=O)OC(=O)C(C)CCC
Synonyms:- Pentanoic acid, 2-methyl-, anhydride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.