CymitQuimica logo

CAS 63177-38-8

:

1-(3-chloropropanoyl)pyrrolidine

Description:
1-(3-Chloropropanoyl)pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The presence of a 3-chloropropanoyl group indicates that the compound has a carbon chain with a chlorine substituent and a carbonyl functional group attached to the nitrogen of the pyrrolidine. This structure contributes to its potential reactivity and solubility properties. The compound may exhibit polar characteristics due to the carbonyl and chlorine functionalities, influencing its interactions with other molecules. It is likely to participate in various chemical reactions, including nucleophilic substitutions and acylation processes, owing to the electrophilic nature of the carbonyl carbon. Additionally, the presence of the chlorine atom can affect the compound's biological activity and stability. As with many organic compounds, safety and handling precautions should be observed, as it may pose health risks or environmental hazards. Overall, 1-(3-chloropropanoyl)pyrrolidine is of interest in synthetic organic chemistry and potentially in pharmaceutical applications.
Formula:C7H12ClNO
InChI:InChI=1/C7H12ClNO/c8-4-3-7(10)9-5-1-2-6-9/h1-6H2
SMILES:C1CCN(C1)C(=O)CCCl
Synonyms:
  • 1-Propanone, 3-Chloro-1-(1-Pyrrolidinyl)-
  • 3-Chloro-1-(Pyrrolidin-1-Yl)Propan-1-One
  • 3-Chloro-1-(1-pyrrolidinyl)-1-propanone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.