CAS 6318-20-3

4-Acetoxy-3,5-dimethoxy benzoic acid

Description:

4-Acetoxy-3,5-dimethoxy benzoic acid, with the CAS number 6318-20-3, is an organic compound characterized by its aromatic structure, which includes a benzoic acid moiety substituted with acetoxy and methoxy groups. This compound typically exhibits a white to off-white crystalline appearance. Its molecular structure features two methoxy groups located at the 3 and 5 positions of the benzene ring, and an acetoxy group at the 4 position, contributing to its chemical reactivity and potential applications. The presence of these functional groups suggests that it may participate in various chemical reactions, such as esterification or nucleophilic substitution. Additionally, the compound may exhibit moderate solubility in organic solvents and limited solubility in water, which is common for many aromatic compounds. Its properties may make it useful in organic synthesis, pharmaceuticals, or as an intermediate in the production of other chemical entities. As with any chemical substance, proper handling and safety precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₁H₁₂O₆

InChI: InChI=1/C11H12O6/c1-6(12)17-10-8(15-2)4-7(11(13)14)5-9(10)16-3/h4-5H,1-3H3,(H,13,14)

SMILES: CC(=O)Oc1c(cc(cc1OC)C(=O)O)OC

Synonyms:

• 4-(Acetyloxy)-3,5-Dimethoxybenzoic Acid

4-Acetoxy-3,5-dimethoxybenzoic acid

CAS: 6318-20-3

4-Acetoxy-3,5-dimethoxybenzoic acid (4ADOB) is a chemical substance that has been shown to have cancer chemotherapeutic properties. It is hydroxylated by the enzyme acetylase, which converts it into 4-acetoxy-3,5-dimethoxybenzoyl coenzyme A (4ADBCA). 4ADBCA inhibits the activity of amine oxidase, an enzyme that breaks down natural substances such as amino acids and neurotransmitters. Inhibition of amine oxidase leads to a decrease in the production of proinflammatory substances and cytokines that play a role in inflammatory diseases.

Formula: C₁₁H₁₂O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 240.21 g/mol

Ref: 3D-FA70714