CAS 6318-41-8

5-(1,3-benzodioxol-5-ylmethylidene)-1,3-thiazolidine-2,4-dione

Description:

5-(1,3-benzodioxol-5-ylmethylidene)-1,3-thiazolidine-2,4-dione, commonly referred to by its CAS number 6318-41-8, is a synthetic organic compound characterized by its thiazolidine core, which is a five-membered ring containing both sulfur and nitrogen. This compound features a benzodioxole moiety, contributing to its aromatic properties and potential biological activity. The presence of the thiazolidine-2,4-dione structure suggests that it may exhibit properties typical of diones, such as reactivity in condensation reactions and potential chelation with metal ions. The compound is of interest in medicinal chemistry due to its structural features, which may influence its pharmacological properties, including anti-inflammatory and antidiabetic activities. Additionally, the benzodioxole group is known for its role in various bioactive compounds, enhancing the compound's potential therapeutic applications. As with many synthetic organic compounds, its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species.

Formula: C₁₁H₇NO₄S

InChI: InChI=1/C11H7NO4S/c13-10-9(17-11(14)12-10)4-6-1-2-7-8(3-6)16-5-15-7/h1-4H,5H2,(H,12,13,14)

SMILES: c1cc2c(cc1C=C1C(=NC(=O)S1)O)OCO2

Synonyms:

• PI 3-Kγ Inhibitor VII - CAS 6318-41-8 - Calbiochem
• 2,4-Thiazolidinedione,5-(1,3-benzodioxol-5-ylmethylene)-
• Inhibitor,PI3Kγ,inhibit,Phosphoinositide 3-kinase,AS 041164,AS-041164,anti-inflammatory,neutrophil,recruitment,AS041164,RANTES,PI3K

2,4-Thiazolidinedione, 5-(1,3-benzodioxol-5-ylmethylene)-

CAS: 6318-41-8

Formula: C₁₁H₇NO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 249.2426

Ref: IN-DA000F0F

AS-041164

CAS: 6318-41-8

AS-041164

Purity: ≥98%

Molecular weight: 249.24g/mol

Ref: 54-BUP11184

AS-041164

CAS: 6318-41-8

AS-041164: Oral PI3Kγ inhibitor, IC50 70 nM; weaker on PI3Kα/β/δ; anti-inflammatory.

Formula: C₁₁H₇NO₄S

Purity: 99.45%

Color and Shape: Solid

Molecular weight: 249.24

Ref: TM-T21938