CymitQuimica logo

CAS 631912-19-1

:

3-Bromo-4-fluorobenzenesulfonyl chloride

Description:
3-Bromo-4-fluorobenzenesulfonyl chloride is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that is further substituted with bromine and fluorine atoms. This compound typically appears as a colorless to pale yellow solid or liquid, depending on its purity and form. It is known for its reactivity, particularly due to the sulfonyl chloride group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially in the preparation of sulfonamides and other derivatives. The presence of both bromine and fluorine substituents can influence its electronic properties and reactivity, potentially enhancing its utility in various chemical transformations. Additionally, this compound should be handled with care, as sulfonyl chlorides can be corrosive and may release toxic gases upon reaction with water or other nucleophiles. Proper safety precautions, including the use of personal protective equipment and working in a fume hood, are essential when working with this substance.
Formula:C6H3BrClFO2S
InChI:InChI=1S/C6H3BrClFO2S/c7-5-3-4(12(8,10)11)1-2-6(5)9/h1-3H
InChI key:BEEHKBVVTWJSRH-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1S(=O)(=O)Cl)Br)F
Found 4 products.