CAS 632-01-9

2,2,3,3,4,4-hexafluoropentane-1,5-diol bis(4-methylbenzenesulfonate)

Description:

2,2,3,3,4,4-Hexafluoropentane-1,5-diol bis(4-methylbenzenesulfonate), with CAS number 632-01-9, is a specialized chemical compound characterized by its unique structure that includes a hexafluorinated pentane backbone and two 4-methylbenzenesulfonate groups. This compound is notable for its high fluorine content, which imparts distinct properties such as increased hydrophobicity and thermal stability. It is typically used in applications requiring strong chemical resistance and may serve as a surfactant or in the formulation of advanced materials. The presence of sulfonate groups enhances its solubility in polar solvents, making it useful in various chemical processes. Additionally, due to its fluorinated nature, it may exhibit low surface tension and unique interfacial properties. Safety considerations are important when handling this compound, as fluorinated compounds can pose environmental and health risks. Overall, its specialized characteristics make it valuable in niche applications within the fields of materials science and chemical engineering.

Formula: C₅H₃F₉

InChI: InChI=1/C5H3F9/c1-2(6,7)3(8,9)4(10,11)5(12,13)14/h1H3

SMILES: CC(C(C(C(F)(F)F)(F)F)(F)F)(F)F

Synonyms:

• 2,2,3,3,4,4-Hexafluoropentane-1,5-diyl bis(4-methylbenzenesulfonate)
• 1,1,1,2,2,3,3,4,4-Nonafluoropentane

2,2,3,3,4,4-Hexafluoropentane-1,5-diyl bis(4-toluenesulphonate)

CAS: 632-01-9

2,2,3,3,4,4-Hexafluoropentane-1,5-diyl bis(4-toluenesulphonate)

Purity: ≥95%

Molecular weight: 520.46g/mol

Ref: 54-PC1731