CymitQuimica logo

CAS 632-07-5

:

2-cyanopropanoic acid

Description:
2-Cyanopropanoic acid, also known as 2-cyano-2-propanoic acid, is an organic compound characterized by the presence of both a cyano group (-CN) and a carboxylic acid group (-COOH) attached to a three-carbon chain. Its molecular formula is C4H7NO2, and it features a propanoic acid backbone with a cyano substituent at the second carbon. This compound is typically a colorless to pale yellow liquid or solid, depending on its state and purity. It is soluble in polar solvents like water and alcohols, owing to its polar functional groups. 2-Cyanopropanoic acid is of interest in organic synthesis, particularly in the production of various pharmaceuticals and agrochemicals. It can participate in reactions such as nucleophilic additions and condensation reactions, making it a versatile intermediate in synthetic chemistry. Additionally, due to the presence of the cyano group, it can undergo hydrolysis to form corresponding carboxylic acids or amines under appropriate conditions. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C4H5NO2
InChI:InChI=1/C4H5NO2/c1-3(2-5)4(6)7/h3H,1H3,(H,6,7)
InChI key:JDEFPFLTCXIVDH-UHFFFAOYSA-N
SMILES:CC(C#N)C(=O)O
Found 4 products.